C25H27N3O2 — CID 10046621
4,6-bis(4-ethoxyphenyl)-1,5,7-trimethylpyrrolo[3,4-d]pyridazine (PubChem CID 10046621) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 4,6-bis(4-ethoxyphenyl)-1,5,7-trimethylpyrrolo[3,4-d]pyridazine.
| Compound Name | 4,6-bis(4-ethoxyphenyl)-1,5,7-trimethylpyrrolo[3,4-d]pyridazine |
|---|---|
| PubChem CID | 10046621 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 4,6-bis(4-ethoxyphenyl)-1,5,7-trimethylpyrrolo[3,4-d]pyridazine |
| SMILES | CCOc1ccc(-c2nnc(C)c3c(C)n(-c4ccc(OCC)cc4)c(C)c23)cc1 |
| InChI | InChI=1S/C25H27N3O2/c1-6-29-21-12-8-19(9-13-21)25-24-18(5)28(17(4)23(24)16(3)26-27-25)20-10-14-22(15-11-20)30-7-2/h8-15H,6-7H2,1-5H3 |
| InChIKey | ZGWYLQITYWVNNW-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |