C21H40O5S — CID 10046839
(9S,10R)-10-(2-carboxyethylsulfanyl)-9-hydroxyoctadecanoic acid (PubChem CID 10046839) has the molecular formula C21H40O5S and a molecular weight of 404.61 g/mol. Its IUPAC name is (9S,10R)-10-(2-carboxyethylsulfanyl)-9-hydroxyoctadecanoic acid.
| Compound Name | (9S,10R)-10-(2-carboxyethylsulfanyl)-9-hydroxyoctadecanoic acid |
|---|---|
| PubChem CID | 10046839 |
| Molecular Formula | C21H40O5S |
| Molecular Weight | 404.61 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | (9S,10R)-10-(2-carboxyethylsulfanyl)-9-hydroxyoctadecanoic acid |
| SMILES | CCCCCCCC[C@@H](SCCC(=O)O)[C@@H](O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C21H40O5S/c1-2-3-4-5-8-11-14-19(27-17-16-21(25)26)18(22)13-10-7-6-9-12-15-20(23)24/h18-19,22H,2-17H2,1H3,(H,23,24)(H,25,26)/t18-,19+/m0/s1 |
| InChIKey | UQASMQXWCPJDFZ-RBUKOAKNSA-N |
| XLogP | 5.49 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|