About N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide
N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide (PubChem CID 10046989) has the molecular formula C28H25NO2
and a molecular weight of 407.51 g/mol. Its IUPAC name is N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide |
| PubChem CID | 10046989 |
| Molecular Formula | C28H25NO2 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide |
| SMILES | O=C(NC(Cc1ccccc1)c1ccc(O)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H25NO2/c30-25-18-16-22(17-19-25)26(20-21-10-4-1-5-11-21)29-28(31)27(23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-19,26-27,30H,20H2,(H,29,31) |
| InChIKey | CYLSAWUUFJEGFC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide?
The IUPAC name of N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide (CID 10046989) is N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide.
What is the SMILES notation for N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide?
The canonical SMILES for N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide is O=C(NC(Cc1ccccc1)c1ccc(O)cc1)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide?
The InChIKey is CYLSAWUUFJEGFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25NO2/c30-25-18-16-22(17-19-25)26(20-21-10-4-1-5-11-21)29-28(31)27(23-12-6-2-7-13-23)24-14-8-3-9-15-24/h1-19,26-27,30H,20H2,(H,29,31).
What are the key properties of N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide?
N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide has a molecular weight of 407.51 g/mol, XLogP of 5.62, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-hydroxyphenyl)-2-phenylethyl]-2,2-diphenylacetamide is sourced from PubChem (CID 10046989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).