About [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol
[6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol (PubChem CID 10047013) has the molecular formula C18H18F6N2O2
and a molecular weight of 408.34 g/mol. Its IUPAC name is [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol.
Molecular Properties
| Compound Name | [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol |
| PubChem CID | 10047013 |
| Molecular Formula | C18H18F6N2O2 |
| Molecular Weight | 408.34 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol |
| SMILES | COc1cc(C(F)(F)F)c2nc(C(F)(F)F)cc(C(O)C3CCCCN3)c2c1 |
| InChI | InChI=1S/C18H18F6N2O2/c1-28-9-6-10-11(16(27)13-4-2-3-5-25-13)8-14(18(22,23)24)26-15(10)12(7-9)17(19,20)21/h6-8,13,16,25,27H,2-5H2,1H3 |
| InChIKey | GFOSNCCJLRKHLB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol?
The IUPAC name of [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol (CID 10047013) is [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol.
What is the SMILES notation for [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol?
The canonical SMILES for [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol is COc1cc(C(F)(F)F)c2nc(C(F)(F)F)cc(C(O)C3CCCCN3)c2c1.
What is the InChIKey of [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol?
The InChIKey is GFOSNCCJLRKHLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18F6N2O2/c1-28-9-6-10-11(16(27)13-4-2-3-5-25-13)8-14(18(22,23)24)26-15(10)12(7-9)17(19,20)21/h6-8,13,16,25,27H,2-5H2,1H3.
What are the key properties of [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol?
[6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol has a molecular weight of 408.34 g/mol, XLogP of 4.46, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [6-methoxy-2,8-bis(trifluoromethyl)quinolin-4-yl]-piperidin-2-ylmethanol is sourced from PubChem (CID 10047013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).