C21H28O6S — CID 10047052
(1S,4S,5R,8S,9S,10R,12S,13R)-10-(benzenesulfonyl)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 10047052) has the molecular formula C21H28O6S and a molecular weight of 408.52 g/mol. Its IUPAC name is (1S,4S,5R,8S,9S,10R,12S,13R)-10-(benzenesulfonyl)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1S,4S,5R,8S,9S,10R,12S,13R)-10-(benzenesulfonyl)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 10047052 |
| Molecular Formula | C21H28O6S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | (1S,4S,5R,8S,9S,10R,12S,13R)-10-(benzenesulfonyl)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C[C@H]1[C@@H]2CC[C@@H](C)[C@@H]3CC[C@]4(C)OO[C@@]23[C@H](O[C@@H]1S(=O)(=O)c1ccccc1)O4 |
| InChI | InChI=1S/C21H28O6S/c1-13-9-10-17-14(2)18(28(22,23)15-7-5-4-6-8-15)24-19-21(17)16(13)11-12-20(3,25-19)26-27-21/h4-8,13-14,16-19H,9-12H2,1-3H3/t13-,14+,16+,17+,18-,19-,20+,21-/m1/s1 |
| InChIKey | RVHHVKGXJYWAFY-URBOQICFSA-N |
| XLogP | 3.67 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|