C21H34O4SSi — CID 10047204
[(1R,2R,4R,6S)-6-triethylsilyloxy-2-bicyclo[2.2.1]heptanyl]methyl 4-methylbenzenesulfonate (PubChem CID 10047204) has the molecular formula C21H34O4SSi and a molecular weight of 410.65 g/mol. Its IUPAC name is [(1R,2R,4R,6S)-6-triethylsilyloxy-2-bicyclo[2.2.1]heptanyl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(1R,2R,4R,6S)-6-triethylsilyloxy-2-bicyclo[2.2.1]heptanyl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10047204 |
| Molecular Formula | C21H34O4SSi |
| Molecular Weight | 410.65 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [(1R,2R,4R,6S)-6-triethylsilyloxy-2-bicyclo[2.2.1]heptanyl]methyl 4-methylbenzenesulfonate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@H]2C[C@@H](COS(=O)(=O)c3ccc(C)cc3)[C@H]1C2 |
| InChI | InChI=1S/C21H34O4SSi/c1-5-27(6-2,7-3)25-21-14-17-12-18(20(21)13-17)15-24-26(22,23)19-10-8-16(4)9-11-19/h8-11,17-18,20-21H,5-7,12-15H2,1-4H3/t17-,18+,20-,21+/m1/s1 |
| InChIKey | ZWTAZRXRVQCAPT-JYRKZWEQSA-N |
| XLogP | 5.14 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.65 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|