C26H26N2O3 — CID 10047419
3-(3-cyclopentyloxy-4-methoxyphenyl)-3-(pyridin-3-ylmethyl)-1H-indol-2-one (PubChem CID 10047419) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-(3-cyclopentyloxy-4-methoxyphenyl)-3-(pyridin-3-ylmethyl)-1H-indol-2-one.
| Compound Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-3-(pyridin-3-ylmethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 10047419 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 3-(3-cyclopentyloxy-4-methoxyphenyl)-3-(pyridin-3-ylmethyl)-1H-indol-2-one |
| SMILES | COc1ccc(C2(Cc3cccnc3)C(=O)Nc3ccccc32)cc1OC1CCCC1 |
| InChI | InChI=1S/C26H26N2O3/c1-30-23-13-12-19(15-24(23)31-20-8-2-3-9-20)26(16-18-7-6-14-27-17-18)21-10-4-5-11-22(21)28-25(26)29/h4-7,10-15,17,20H,2-3,8-9,16H2,1H3,(H,28,29) |
| InChIKey | MFGKXUMOPKIESN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |