C18H15BrN4O3 — CID 10047448
1-[(6-bromo-10,11-dioxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-yl)methyl]-3-phenylurea (PubChem CID 10047448) has the molecular formula C18H15BrN4O3 and a molecular weight of 415.25 g/mol. Its IUPAC name is 1-[(6-bromo-10,11-dioxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-yl)methyl]-3-phenylurea.
| Compound Name | 1-[(6-bromo-10,11-dioxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-yl)methyl]-3-phenylurea |
|---|---|
| PubChem CID | 10047448 |
| Molecular Formula | C18H15BrN4O3 |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | 1-[(6-bromo-10,11-dioxo-1,9-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-yl)methyl]-3-phenylurea |
| SMILES | O=C(NCC1Cc2cc(Br)cc3[nH]c(=O)c(=O)n1c23)Nc1ccccc1 |
| InChI | InChI=1S/C18H15BrN4O3/c19-11-6-10-7-13(9-20-18(26)21-12-4-2-1-3-5-12)23-15(10)14(8-11)22-16(24)17(23)25/h1-6,8,13H,7,9H2,(H,22,24)(H2,20,21,26) |
| InChIKey | WJBDCKCHOPXOKC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|