C26H46O2Si — CID 10047663
(1R,5S,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,8a-dimethyl-2-methylidene-5-(4-methylpent-3-enyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carbaldehyde (PubChem CID 10047663) has the molecular formula C26H46O2Si and a molecular weight of 418.74 g/mol. Its IUPAC name is (1R,5S,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,8a-dimethyl-2-methylidene-5-(4-methylpent-3-enyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carbaldehyde.
| Compound Name | (1R,5S,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,8a-dimethyl-2-methylidene-5-(4-methylpent-3-enyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 10047663 |
| Molecular Formula | C26H46O2Si |
| Molecular Weight | 418.74 g/mol |
| Exact Mass | 418.33 |
| IUPAC Name | (1R,5S,6S,8aS)-6-[tert-butyl(dimethyl)silyl]oxy-5,8a-dimethyl-2-methylidene-5-(4-methylpent-3-enyl)-3,4,4a,6,7,8-hexahydro-1H-naphthalene-1-carbaldehyde |
| SMILES | C=C1CCC2[C@](C)(CCC=C(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)[C@@H]1C=O |
| InChI | InChI=1S/C26H46O2Si/c1-19(2)12-11-16-26(8)22-14-13-20(3)21(18-27)25(22,7)17-15-23(26)28-29(9,10)24(4,5)6/h12,18,21-23H,3,11,13-17H2,1-2,4-10H3/t21-,22?,23+,25-,26+/m1/s1 |
| InChIKey | DULBSOQMIFVNFG-LEAUDNCJSA-N |
| XLogP | 7.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.74 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|