C23H20N2O4S — CID 10047758
4,6-diphenyl-2-sulfanylidene-1-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]pyridine-3-carbonitrile (PubChem CID 10047758) has the molecular formula C23H20N2O4S and a molecular weight of 420.49 g/mol. Its IUPAC name is 4,6-diphenyl-2-sulfanylidene-1-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]pyridine-3-carbonitrile.
| Compound Name | 4,6-diphenyl-2-sulfanylidene-1-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 10047758 |
| Molecular Formula | C23H20N2O4S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 4,6-diphenyl-2-sulfanylidene-1-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2ccccc2)n([C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)c1=S |
| InChI | InChI=1S/C23H20N2O4S/c24-12-17-16(14-7-3-1-4-8-14)11-18(15-9-5-2-6-10-15)25(23(17)30)22-21(28)20(27)19(26)13-29-22/h1-11,19-22,26-28H,13H2/t19-,20+,21-,22-/m1/s1 |
| InChIKey | SVLDXWDIWOKSIW-CIAFKFPVSA-N |
| XLogP | 3.03 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|