About 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea
1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea (PubChem CID 10047904) has the molecular formula C21H24Cl2N2O3
and a molecular weight of 423.34 g/mol. Its IUPAC name is 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea |
| PubChem CID | 10047904 |
| Molecular Formula | C21H24Cl2N2O3 |
| Molecular Weight | 423.34 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea |
| SMILES | CC(C)(C)c1ccc(OC2CCOC2)c(NC(=O)Nc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C21H24Cl2N2O3/c1-21(2,3)13-7-8-18(28-14-9-10-27-12-14)17(11-13)25-20(26)24-16-6-4-5-15(22)19(16)23/h4-8,11,14H,9-10,12H2,1-3H3,(H2,24,25,26) |
| InChIKey | AUWOOQSOMNALEH-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.34 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea?
The IUPAC name of 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea (CID 10047904) is 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea.
What is the SMILES notation for 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea?
The canonical SMILES for 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea is CC(C)(C)c1ccc(OC2CCOC2)c(NC(=O)Nc2cccc(Cl)c2Cl)c1.
What is the InChIKey of 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea?
The InChIKey is AUWOOQSOMNALEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24Cl2N2O3/c1-21(2,3)13-7-8-18(28-14-9-10-27-12-14)17(11-13)25-20(26)24-16-6-4-5-15(22)19(16)23/h4-8,11,14H,9-10,12H2,1-3H3,(H2,24,25,26).
What are the key properties of 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea?
1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea has a molecular weight of 423.34 g/mol, XLogP of 6.10, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-tert-butyl-2-(oxolan-3-yloxy)phenyl]-3-(2,3-dichlorophenyl)urea is sourced from PubChem (CID 10047904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).