C17H27F3N4O3S — CID 10047981
3-[2-[amino-(3,3,5-trimethylcyclohexyl)amino]acetyl]-1,3-thiazolidine-4-carbonitrile;2,2,2-trifluoroacetic acid (PubChem CID 10047981) has the molecular formula C17H27F3N4O3S and a molecular weight of 424.49 g/mol. Its IUPAC name is 3-[2-[amino-(3,3,5-trimethylcyclohexyl)amino]acetyl]-1,3-thiazolidine-4-carbonitrile;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[amino-(3,3,5-trimethylcyclohexyl)amino]acetyl]-1,3-thiazolidine-4-carbonitrile;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 10047981 |
| Molecular Formula | C17H27F3N4O3S |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3-[2-[amino-(3,3,5-trimethylcyclohexyl)amino]acetyl]-1,3-thiazolidine-4-carbonitrile;2,2,2-trifluoroacetic acid |
| SMILES | CC1CC(N(N)CC(=O)N2CSCC2C#N)CC(C)(C)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H26N4OS.C2HF3O2/c1-11-4-12(6-15(2,3)5-11)19(17)8-14(20)18-10-21-9-13(18)7-16;3-2(4,5)1(6)7/h11-13H,4-6,8-10,17H2,1-3H3;(H,6,7) |
| InChIKey | FFKNZTMEEDUEAT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 110.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|