C16H15ClN4O4S2 — CID 10048137
5-[4-(4-chlorophenyl)sulfonylphenyl]-4-ethyl-1,2,4-triazole-3-sulfonamide (PubChem CID 10048137) has the molecular formula C16H15ClN4O4S2 and a molecular weight of 426.91 g/mol. Its IUPAC name is 5-[4-(4-chlorophenyl)sulfonylphenyl]-4-ethyl-1,2,4-triazole-3-sulfonamide.
| Compound Name | 5-[4-(4-chlorophenyl)sulfonylphenyl]-4-ethyl-1,2,4-triazole-3-sulfonamide |
|---|---|
| PubChem CID | 10048137 |
| Molecular Formula | C16H15ClN4O4S2 |
| Molecular Weight | 426.91 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | 5-[4-(4-chlorophenyl)sulfonylphenyl]-4-ethyl-1,2,4-triazole-3-sulfonamide |
| SMILES | CCn1c(-c2ccc(S(=O)(=O)c3ccc(Cl)cc3)cc2)nnc1S(N)(=O)=O |
| InChI | InChI=1S/C16H15ClN4O4S2/c1-2-21-15(19-20-16(21)27(18,24)25)11-3-7-13(8-4-11)26(22,23)14-9-5-12(17)6-10-14/h3-10H,2H2,1H3,(H2,18,24,25) |
| InChIKey | NNHGCSLPOLOFCW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.91 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |