C22H43NO5Si — CID 10048288
tert-butyl (4S,5S)-4-[(E,1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypent-3-enyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10048288) has the molecular formula C22H43NO5Si and a molecular weight of 429.67 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-[(E,1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypent-3-enyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S,5S)-4-[(E,1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypent-3-enyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10048288 |
| Molecular Formula | C22H43NO5Si |
| Molecular Weight | 429.67 g/mol |
| Exact Mass | 429.29 |
| IUPAC Name | tert-butyl (4S,5S)-4-[(E,1S,2S)-2-[tert-butyl(dimethyl)silyl]oxy-1-hydroxypent-3-enyl]-2,2,5-trimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]1[C@H](C)OC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H43NO5Si/c1-13-14-16(28-29(11,12)21(6,7)8)18(24)17-15(2)26-22(9,10)23(17)19(25)27-20(3,4)5/h13-18,24H,1-12H3/b14-13+/t15-,16-,17+,18+/m0/s1 |
| InChIKey | PLQCABDLZSTRAM-LXRLNOOASA-N |
| XLogP | 5.07 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|