C21H30N6O4 — CID 10048329
4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(3,5-dimethoxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 10048329) has the molecular formula C21H30N6O4 and a molecular weight of 430.51 g/mol. Its IUPAC name is 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(3,5-dimethoxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(3,5-dimethoxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 10048329 |
| Molecular Formula | C21H30N6O4 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 4-N-[[4-(aminomethyl)cyclohexyl]methyl]-2-N-[(3,5-dimethoxyphenyl)methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | COc1cc(CNc2ncc([N+](=O)[O-])c(NCC3CCC(CN)CC3)n2)cc(OC)c1 |
| InChI | InChI=1S/C21H30N6O4/c1-30-17-7-16(8-18(9-17)31-2)12-24-21-25-13-19(27(28)29)20(26-21)23-11-15-5-3-14(10-22)4-6-15/h7-9,13-15H,3-6,10-12,22H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | WCFVFQFDUILXMN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|