About N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine
N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine (PubChem CID 10048341) has the molecular formula C27H30N2O3
and a molecular weight of 430.55 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine.
Molecular Properties
| Compound Name | N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine |
| PubChem CID | 10048341 |
| Molecular Formula | C27H30N2O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine |
| SMILES | CCOC(C/N=C/c1cc(C)c2[nH]c3ccc(Oc4ccccc4)cc3c2c1C)OCC |
| InChI | InChI=1S/C27H30N2O3/c1-5-30-25(31-6-2)17-28-16-20-14-18(3)27-26(19(20)4)23-15-22(12-13-24(23)29-27)32-21-10-8-7-9-11-21/h7-16,25,29H,5-6,17H2,1-4H3/b28-16+ |
| InChIKey | XSQDELRFRUZOOL-LQKURTRISA-N |
| XLogP | 6.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine?
The IUPAC name of N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine (CID 10048341) is N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine.
What is the SMILES notation for N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine?
The canonical SMILES for N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine is CCOC(C/N=C/c1cc(C)c2[nH]c3ccc(Oc4ccccc4)cc3c2c1C)OCC.
What is the InChIKey of N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine?
The InChIKey is XSQDELRFRUZOOL-LQKURTRISA-N. The full InChI is InChI=1S/C27H30N2O3/c1-5-30-25(31-6-2)17-28-16-20-14-18(3)27-26(19(20)4)23-15-22(12-13-24(23)29-27)32-21-10-8-7-9-11-21/h7-16,25,29H,5-6,17H2,1-4H3/b28-16+.
What are the key properties of N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine?
N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine has a molecular weight of 430.55 g/mol, XLogP of 6.55, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-diethoxyethyl)-1-(1,4-dimethyl-6-phenoxy-9H-carbazol-3-yl)methanimine is sourced from PubChem (CID 10048341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).