C28H31FN2O — CID 10048345
(1S)-1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-2-(2,4-dimethylphenyl)ethanol (PubChem CID 10048345) has the molecular formula C28H31FN2O and a molecular weight of 430.57 g/mol. Its IUPAC name is (1S)-1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-2-(2,4-dimethylphenyl)ethanol.
| Compound Name | (1S)-1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-2-(2,4-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 10048345 |
| Molecular Formula | C28H31FN2O |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | (1S)-1-[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-2-(2,4-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C[C@H](O)[C@H]2CCCC3=Cc4c(cnn4-c4ccc(F)cc4)C[C@@]32C)c(C)c1 |
| InChI | InChI=1S/C28H31FN2O/c1-18-7-8-20(19(2)13-18)14-27(32)25-6-4-5-22-15-26-21(16-28(22,25)3)17-30-31(26)24-11-9-23(29)10-12-24/h7-13,15,17,25,27,32H,4-6,14,16H2,1-3H3/t25-,27+,28+/m1/s1 |
| InChIKey | LEAZYPIXRKCBSP-PKXQUSJVSA-N |
| XLogP | 5.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |