C25H15N5OS — CID 10048497
14-[(E)-benzylideneamino]-13-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one (PubChem CID 10048497) has the molecular formula C25H15N5OS and a molecular weight of 433.50 g/mol. Its IUPAC name is 14-[(E)-benzylideneamino]-13-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one.
| Compound Name | 14-[(E)-benzylideneamino]-13-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one |
|---|---|
| PubChem CID | 10048497 |
| Molecular Formula | C25H15N5OS |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 14-[(E)-benzylideneamino]-13-phenyl-17-thia-2,9,12,14-tetrazatetracyclo[8.7.0.03,8.011,16]heptadeca-1,3,5,7,9,11(16),12-heptaen-15-one |
| SMILES | O=c1c2sc3nc4ccccc4nc3c2nc(-c2ccccc2)n1/N=C/c1ccccc1 |
| InChI | InChI=1S/C25H15N5OS/c31-25-22-20(21-24(32-22)28-19-14-8-7-13-18(19)27-21)29-23(17-11-5-2-6-12-17)30(25)26-15-16-9-3-1-4-10-16/h1-15H/b26-15+ |
| InChIKey | KFECPNFFGFHSRA-CVKSISIWSA-N |
| XLogP | 5.10 |
| TPSA | 73.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|