C31H50O — CID 10048803
(3S)-3-[(3E,7E,11E,15Z)-16-ethenyl-3,7,12,20-tetramethylhenicosa-3,7,11,15,19-pentaenyl]-2,2-dimethyloxirane (PubChem CID 10048803) has the molecular formula C31H50O and a molecular weight of 438.74 g/mol. Its IUPAC name is (3S)-3-[(3E,7E,11E,15Z)-16-ethenyl-3,7,12,20-tetramethylhenicosa-3,7,11,15,19-pentaenyl]-2,2-dimethyloxirane.
| Compound Name | (3S)-3-[(3E,7E,11E,15Z)-16-ethenyl-3,7,12,20-tetramethylhenicosa-3,7,11,15,19-pentaenyl]-2,2-dimethyloxirane |
|---|---|
| PubChem CID | 10048803 |
| Molecular Formula | C31H50O |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 438.39 |
| IUPAC Name | (3S)-3-[(3E,7E,11E,15Z)-16-ethenyl-3,7,12,20-tetramethylhenicosa-3,7,11,15,19-pentaenyl]-2,2-dimethyloxirane |
| SMILES | C=C/C(=C\CC/C(C)=C/CC/C=C(\C)CC/C=C(\C)CC[C@@H]1OC1(C)C)CCC=C(C)C |
| InChI | InChI=1S/C31H50O/c1-9-29(21-12-15-25(2)3)22-14-20-27(5)17-11-10-16-26(4)18-13-19-28(6)23-24-30-31(7,8)32-30/h9,15-17,19,22,30H,1,10-14,18,20-21,23-24H2,2-8H3/b26-16+,27-17+,28-19+,29-22+/t30-/m0/s1 |
| InChIKey | ATMHMBRPCUZUGJ-WKMIMHNDSA-N |
| XLogP | 9.98 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|