About N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine
N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine (PubChem CID 10048827) has the molecular formula C21H21N5O4S
and a molecular weight of 439.50 g/mol. Its IUPAC name is N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine |
| PubChem CID | 10048827 |
| Molecular Formula | C21H21N5O4S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine |
| SMILES | CCS(=O)(=O)c1ccc(OCCn2ccnn2)c(Nc2ncc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C21H21N5O4S/c1-2-31(27,28)17-8-9-19(29-13-12-26-11-10-23-25-26)18(14-17)24-21-22-15-20(30-21)16-6-4-3-5-7-16/h3-11,14-15H,2,12-13H2,1H3,(H,22,24) |
| InChIKey | MQOWMHDYMDSXQS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine?
The IUPAC name of N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine (CID 10048827) is N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine.
What is the SMILES notation for N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine?
The canonical SMILES for N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine is CCS(=O)(=O)c1ccc(OCCn2ccnn2)c(Nc2ncc(-c3ccccc3)o2)c1.
What is the InChIKey of N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine?
The InChIKey is MQOWMHDYMDSXQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N5O4S/c1-2-31(27,28)17-8-9-19(29-13-12-26-11-10-23-25-26)18(14-17)24-21-22-15-20(30-21)16-6-4-3-5-7-16/h3-11,14-15H,2,12-13H2,1H3,(H,22,24).
What are the key properties of N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine?
N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine has a molecular weight of 439.50 g/mol, XLogP of 3.55, 9 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-ethylsulfonyl-2-[2-(triazol-1-yl)ethoxy]phenyl]-5-phenyl-1,3-oxazol-2-amine is sourced from PubChem (CID 10048827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).