C24H30FN5O2 — CID 10048840
1-[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]-N,N-dimethylmethanamine (PubChem CID 10048840) has the molecular formula C24H30FN5O2 and a molecular weight of 439.54 g/mol. Its IUPAC name is 1-[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]-N,N-dimethylmethanamine.
| Compound Name | 1-[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 10048840 |
| Molecular Formula | C24H30FN5O2 |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 1-[6-[[(7R,9aS)-2-(5-fluoro-1,2-benzoxazol-3-yl)-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-7-yl]methoxy]-2-pyridinyl]-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cccc(OC[C@@H]2CC[C@H]3CN(c4noc5ccc(F)cc45)CCN3C2)n1 |
| InChI | InChI=1S/C24H30FN5O2/c1-28(2)14-19-4-3-5-23(26-19)31-16-17-6-8-20-15-30(11-10-29(20)13-17)24-21-12-18(25)7-9-22(21)32-27-24/h3-5,7,9,12,17,20H,6,8,10-11,13-16H2,1-2H3/t17-,20+/m1/s1 |
| InChIKey | CSGMAPHXNZBJNQ-XLIONFOSSA-N |
| XLogP | 3.40 |
| TPSA | 57.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |