C24H24F3NO4 — CID 10049268
4-methoxy-3-[5,5,5-trifluoro-4-hydroxy-2-methyl-4-[(4-oxoquinolin-1-yl)methyl]pentan-2-yl]benzaldehyde (PubChem CID 10049268) has the molecular formula C24H24F3NO4 and a molecular weight of 447.45 g/mol. Its IUPAC name is 4-methoxy-3-[5,5,5-trifluoro-4-hydroxy-2-methyl-4-[(4-oxoquinolin-1-yl)methyl]pentan-2-yl]benzaldehyde.
| Compound Name | 4-methoxy-3-[5,5,5-trifluoro-4-hydroxy-2-methyl-4-[(4-oxoquinolin-1-yl)methyl]pentan-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 10049268 |
| Molecular Formula | C24H24F3NO4 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 4-methoxy-3-[5,5,5-trifluoro-4-hydroxy-2-methyl-4-[(4-oxoquinolin-1-yl)methyl]pentan-2-yl]benzaldehyde |
| SMILES | COc1ccc(C=O)cc1C(C)(C)CC(O)(Cn1ccc(=O)c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C24H24F3NO4/c1-22(2,18-12-16(13-29)8-9-21(18)32-3)14-23(31,24(25,26)27)15-28-11-10-20(30)17-6-4-5-7-19(17)28/h4-13,31H,14-15H2,1-3H3 |
| InChIKey | UGVCZTSSOBWRSB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|