C28H28N2NaO2 — CID 10049329
CID 10049329 (PubChem CID 10049329) has the molecular formula C28H28N2NaO2 and a molecular weight of 447.53 g/mol.
| Compound Name | CID 10049329 |
|---|---|
| PubChem CID | 10049329 |
| Molecular Formula | C28H28N2NaO2 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | — |
| SMILES | O=C(O)CC1CC2(CCN(Cc3ccc4c(c3)[nH]c3ccccc34)CC2)c2ccccc21.[Na] |
| InChI | InChI=1S/C28H28N2O2.Na/c31-27(32)16-20-17-28(24-7-3-1-5-21(20)24)11-13-30(14-12-28)18-19-9-10-23-22-6-2-4-8-25(22)29-26(23)15-19;/h1-10,15,20,29H,11-14,16-18H2,(H,31,32); |
| InChIKey | SVPOSQMHCQGEHX-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |