C27H32N2O4 — CID 10049335
4-[2-[[(E)-3-(1-pentylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid (PubChem CID 10049335) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 4-[2-[[(E)-3-(1-pentylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[(E)-3-(1-pentylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 10049335 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 4-[2-[[(E)-3-(1-pentylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid |
| SMILES | CCCCCn1ccc2cc(/C(C)=C/C(=O)Nc3ccccc3OCCCC(=O)O)ccc21 |
| InChI | InChI=1S/C27H32N2O4/c1-3-4-7-15-29-16-14-22-19-21(12-13-24(22)29)20(2)18-26(30)28-23-9-5-6-10-25(23)33-17-8-11-27(31)32/h5-6,9-10,12-14,16,18-19H,3-4,7-8,11,15,17H2,1-2H3,(H,28,30)(H,31,32)/b20-18+ |
| InChIKey | BTFBFGVGTPPUKN-CZIZESTLSA-N |
| XLogP | 6.12 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|