About [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate
[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate (PubChem CID 10049478) has the molecular formula C23H18FN3O6
and a molecular weight of 451.41 g/mol. Its IUPAC name is [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate.
Molecular Properties
| Compound Name | [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate |
| PubChem CID | 10049478 |
| Molecular Formula | C23H18FN3O6 |
| Molecular Weight | 451.41 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate |
| SMILES | O=C(Oc1c2c(c(O)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2=O)N1CCOCC1 |
| InChI | InChI=1S/C23H18FN3O6/c24-14-5-3-13(4-6-14)12-27-21(29)16-17(22(27)30)20(15-2-1-7-25-18(15)19(16)28)33-23(31)26-8-10-32-11-9-26/h1-7,28H,8-12H2 |
| InChIKey | XYNZHKUCABJGDK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 109.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 451.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate?
The IUPAC name of [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate (CID 10049478) is [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate.
What is the SMILES notation for [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate?
The canonical SMILES for [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate is O=C(Oc1c2c(c(O)c3ncccc13)C(=O)N(Cc1ccc(F)cc1)C2=O)N1CCOCC1.
What is the InChIKey of [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate?
The InChIKey is XYNZHKUCABJGDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18FN3O6/c24-14-5-3-13(4-6-14)12-27-21(29)16-17(22(27)30)20(15-2-1-7-25-18(15)19(16)28)33-23(31)26-8-10-32-11-9-26/h1-7,28H,8-12H2.
What are the key properties of [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate?
[7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate has a molecular weight of 451.41 g/mol, XLogP of 2.71, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [7-[(4-fluorophenyl)methyl]-9-hydroxy-6,8-dioxopyrrolo[3,4-g]quinolin-5-yl] morpholine-4-carboxylate is sourced from PubChem (CID 10049478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).