C20H41N2O7P — CID 10049526
[[(2S)-2,3-di(hexanoyloxy)propyl]amino]-[2-(trimethylazaniumyl)ethoxy]phosphinate (PubChem CID 10049526) has the molecular formula C20H41N2O7P and a molecular weight of 452.53 g/mol. Its IUPAC name is [[(2S)-2,3-di(hexanoyloxy)propyl]amino]-[2-(trimethylazaniumyl)ethoxy]phosphinate.
| Compound Name | [[(2S)-2,3-di(hexanoyloxy)propyl]amino]-[2-(trimethylazaniumyl)ethoxy]phosphinate |
|---|---|
| PubChem CID | 10049526 |
| Molecular Formula | C20H41N2O7P |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | [[(2S)-2,3-di(hexanoyloxy)propyl]amino]-[2-(trimethylazaniumyl)ethoxy]phosphinate |
| SMILES | CCCCCC(=O)OC[C@H](CNP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCC |
| InChI | InChI=1S/C20H41N2O7P/c1-6-8-10-12-19(23)27-17-18(29-20(24)13-11-9-7-2)16-21-30(25,26)28-15-14-22(3,4)5/h18H,6-17H2,1-5H3,(H-,21,25,26)/t18-/m0/s1 |
| InChIKey | VVTFXORSLDXYAX-SFHVURJKSA-N |
| XLogP | 2.38 |
| TPSA | 113.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|