C28H28N4O2 — CID 10049533
N-[2-[4-[(2-methylcyclohexanecarbonyl)amino]phenyl]-1H-indol-5-yl]pyridine-2-carboxamide (PubChem CID 10049533) has the molecular formula C28H28N4O2 and a molecular weight of 452.56 g/mol. Its IUPAC name is N-[2-[4-[(2-methylcyclohexanecarbonyl)amino]phenyl]-1H-indol-5-yl]pyridine-2-carboxamide.
| Compound Name | N-[2-[4-[(2-methylcyclohexanecarbonyl)amino]phenyl]-1H-indol-5-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 10049533 |
| Molecular Formula | C28H28N4O2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | N-[2-[4-[(2-methylcyclohexanecarbonyl)amino]phenyl]-1H-indol-5-yl]pyridine-2-carboxamide |
| SMILES | CC1CCCCC1C(=O)Nc1ccc(-c2cc3cc(NC(=O)c4ccccn4)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C28H28N4O2/c1-18-6-2-3-7-23(18)27(33)30-21-11-9-19(10-12-21)26-17-20-16-22(13-14-24(20)32-26)31-28(34)25-8-4-5-15-29-25/h4-5,8-18,23,32H,2-3,6-7H2,1H3,(H,30,33)(H,31,34) |
| InChIKey | AHRPPVZTEBPFEE-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |