About [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate
[4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate (PubChem CID 10049607) has the molecular formula C24H22O9
and a molecular weight of 454.43 g/mol. Its IUPAC name is [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate.
Molecular Properties
| Compound Name | [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate |
| PubChem CID | 10049607 |
| Molecular Formula | C24H22O9 |
| Molecular Weight | 454.43 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate |
| SMILES | CC(=O)Oc1c(O)c(-c2ccc(O)cc2)c(OC(=O)C[C@H](C)O)c(O)c1-c1ccc(O)cc1 |
| InChI | InChI=1S/C24H22O9/c1-12(25)11-18(29)33-24-20(15-5-9-17(28)10-6-15)21(30)23(32-13(2)26)19(22(24)31)14-3-7-16(27)8-4-14/h3-10,12,25,27-28,30-31H,11H2,1-2H3/t12-/m0/s1 |
| InChIKey | TUDASCLVGVCARU-LBPRGKRZSA-N |
| XLogP | 3.44 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 454.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate?
The IUPAC name of [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate (CID 10049607) is [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate.
What is the SMILES notation for [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate?
The canonical SMILES for [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate is CC(=O)Oc1c(O)c(-c2ccc(O)cc2)c(OC(=O)C[C@H](C)O)c(O)c1-c1ccc(O)cc1.
What is the InChIKey of [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate?
The InChIKey is TUDASCLVGVCARU-LBPRGKRZSA-N. The full InChI is InChI=1S/C24H22O9/c1-12(25)11-18(29)33-24-20(15-5-9-17(28)10-6-15)21(30)23(32-13(2)26)19(22(24)31)14-3-7-16(27)8-4-14/h3-10,12,25,27-28,30-31H,11H2,1-2H3/t12-/m0/s1.
What are the key properties of [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate?
[4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate has a molecular weight of 454.43 g/mol, XLogP of 3.44, 6 rotatable bonds, 5 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [4-acetyloxy-2,5-dihydroxy-3,6-bis(4-hydroxyphenyl)phenyl] (3S)-3-hydroxybutanoate is sourced from PubChem (CID 10049607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).