C27H26N4O3 — CID 10049619
4-methyl-3-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-N-(3-morpholin-4-ylphenyl)benzamide (PubChem CID 10049619) has the molecular formula C27H26N4O3 and a molecular weight of 454.53 g/mol. Its IUPAC name is 4-methyl-3-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-N-(3-morpholin-4-ylphenyl)benzamide.
| Compound Name | 4-methyl-3-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-N-(3-morpholin-4-ylphenyl)benzamide |
|---|---|
| PubChem CID | 10049619 |
| Molecular Formula | C27H26N4O3 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 4-methyl-3-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]-N-(3-morpholin-4-ylphenyl)benzamide |
| SMILES | Cc1nnc(-c2ccc(-c3cc(C(=O)Nc4cccc(N5CCOCC5)c4)ccc3C)cc2)o1 |
| InChI | InChI=1S/C27H26N4O3/c1-18-6-7-22(16-25(18)20-8-10-21(11-9-20)27-30-29-19(2)34-27)26(32)28-23-4-3-5-24(17-23)31-12-14-33-15-13-31/h3-11,16-17H,12-15H2,1-2H3,(H,28,32) |
| InChIKey | XYEIQUMBGNEFIN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_I(4)', 'substructure': 'N/A'} |
|---|