C28H38O5 — CID 10049633
(2R,4aR,6S,7S,8R,8aR)-6-benzyl-7,8-dibutoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 10049633) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aR)-6-benzyl-7,8-dibutoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7S,8R,8aR)-6-benzyl-7,8-dibutoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 10049633 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aR)-6-benzyl-7,8-dibutoxy-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CCCCO[C@@H]1[C@@H](OCCCC)[C@H](Cc2ccccc2)O[C@@H]2CO[C@@H](c3ccccc3)O[C@@H]12 |
| InChI | InChI=1S/C28H38O5/c1-3-5-17-29-25-23(19-21-13-9-7-10-14-21)32-24-20-31-28(22-15-11-8-12-16-22)33-26(24)27(25)30-18-6-4-2/h7-16,23-28H,3-6,17-20H2,1-2H3/t23-,24+,25-,26+,27+,28+/m0/s1 |
| InChIKey | IHCAZPPKGZLTNQ-HZQMJYJGSA-N |
| XLogP | 5.48 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|