C23H37NO8 — CID 10049669
[(1R,2S,4R,8S,9R,11R,12S)-1,12-dihydroxy-2,11-dimethyl-7-(morpholin-4-ylmethyl)-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate (PubChem CID 10049669) has the molecular formula C23H37NO8 and a molecular weight of 455.55 g/mol. Its IUPAC name is [(1R,2S,4R,8S,9R,11R,12S)-1,12-dihydroxy-2,11-dimethyl-7-(morpholin-4-ylmethyl)-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate.
| Compound Name | [(1R,2S,4R,8S,9R,11R,12S)-1,12-dihydroxy-2,11-dimethyl-7-(morpholin-4-ylmethyl)-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 10049669 |
| Molecular Formula | C23H37NO8 |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | [(1R,2S,4R,8S,9R,11R,12S)-1,12-dihydroxy-2,11-dimethyl-7-(morpholin-4-ylmethyl)-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradecan-9-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@@H]1C[C@@]2(C)O[C@](O)(C[C@@H]2O)[C@@H](C)C[C@H]2OC(=O)C(CN3CCOCC3)[C@H]12 |
| InChI | InChI=1S/C23H37NO8/c1-13(2)20(26)31-17-10-22(4)18(25)11-23(28,32-22)14(3)9-16-19(17)15(21(27)30-16)12-24-5-7-29-8-6-24/h13-19,25,28H,5-12H2,1-4H3/t14-,15?,16+,17+,18-,19-,22+,23+/m0/s1 |
| InChIKey | MMZOOLLYUPRILI-XPQKIMOCSA-N |
| XLogP | 0.70 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |