C28H44O5 — CID 10049920
2-[[(2R,3R,3aS,6aS)-3-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxiran-2-yl)-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy]oxane (PubChem CID 10049920) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is 2-[[(2R,3R,3aS,6aS)-3-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxiran-2-yl)-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy]oxane.
| Compound Name | 2-[[(2R,3R,3aS,6aS)-3-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxiran-2-yl)-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy]oxane |
|---|---|
| PubChem CID | 10049920 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | 2-[[(2R,3R,3aS,6aS)-3-[(E,3S)-3-(oxan-2-yloxy)oct-1-enyl]-5-(oxiran-2-yl)-1,2,3,3a,4,6a-hexahydropentalen-2-yl]oxy]oxane |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@H]2CC(C3CO3)=C[C@H]2C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C28H44O5/c1-2-3-4-9-22(32-27-10-5-7-14-29-27)12-13-23-24-17-21(26-19-31-26)16-20(24)18-25(23)33-28-11-6-8-15-30-28/h12-13,16,20,22-28H,2-11,14-15,17-19H2,1H3/b13-12+/t20-,22-,23+,24-,25+,26?,27?,28?/m0/s1 |
| InChIKey | MEUPWCCQWLDJIJ-TYKZUEQWSA-N |
| XLogP | 5.93 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|