C19H37IO3Si — CID 10050289
2-[[(2S)-2-[(2R,5S,6R)-6-[(E)-1-iodobut-1-en-2-yl]-5-methyloxan-2-yl]propoxy]methoxy]ethyl-trimethylsilane (PubChem CID 10050289) has the molecular formula C19H37IO3Si and a molecular weight of 468.49 g/mol. Its IUPAC name is 2-[[(2S)-2-[(2R,5S,6R)-6-[(E)-1-iodobut-1-en-2-yl]-5-methyloxan-2-yl]propoxy]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(2S)-2-[(2R,5S,6R)-6-[(E)-1-iodobut-1-en-2-yl]-5-methyloxan-2-yl]propoxy]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 10050289 |
| Molecular Formula | C19H37IO3Si |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | 2-[[(2S)-2-[(2R,5S,6R)-6-[(E)-1-iodobut-1-en-2-yl]-5-methyloxan-2-yl]propoxy]methoxy]ethyl-trimethylsilane |
| SMILES | CC/C(=C\I)[C@@H]1O[C@@H]([C@@H](C)COCOCC[Si](C)(C)C)CC[C@@H]1C |
| InChI | InChI=1S/C19H37IO3Si/c1-7-17(12-20)19-15(2)8-9-18(23-19)16(3)13-22-14-21-10-11-24(4,5)6/h12,15-16,18-19H,7-11,13-14H2,1-6H3/b17-12+/t15-,16-,18+,19+/m0/s1 |
| InChIKey | BJSRCQBREXYHBI-MBFMLSIISA-N |
| XLogP | 5.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|