C31H33FN2O — CID 10050311
1'-[4-[1-(4-Fluorophenyl)indol-3-yl]butyl]spiro[3,4-dihydroisochromene-1,4'-piperidine] (PubChem CID 10050311) has the molecular formula C31H33FN2O and a molecular weight of 468.60 g/mol. Its IUPAC name is 1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]spiro[3,4-dihydroisochromene-1,4'-piperidine].
| Compound Name | 1'-[4-[1-(4-Fluorophenyl)indol-3-yl]butyl]spiro[3,4-dihydroisochromene-1,4'-piperidine] |
|---|---|
| PubChem CID | 10050311 |
| Molecular Formula | C31H33FN2O |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]spiro[3,4-dihydroisochromene-1,4'-piperidine] |
| SMILES | C1COC2(CCN(CC2)CCCCC3=CN(C4=CC=CC=C43)C5=CC=C(C=C5)F)C6=CC=CC=C61 |
| InChI | InChI=1S/C31H33FN2O/c32-26-12-14-27(15-13-26)34-23-25(28-9-2-4-11-30(28)34)8-5-6-19-33-20-17-31(18-21-33)29-10-3-1-7-24(29)16-22-35-31/h1-4,7,9-15,23H,5-6,8,16-22H2 |
| InChIKey | PFINSXVGGKKXNR-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | 671 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|