C23H27Cl2N3O3S — CID 100504416
(3S)-1-[(2,6-dichlorophenyl)methylsulfonyl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-3-carboxamide (PubChem CID 100504416) has the molecular formula C23H27Cl2N3O3S and a molecular weight of 496.46 g/mol. Its IUPAC name is (3S)-1-[(2,6-dichlorophenyl)methylsulfonyl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-1-[(2,6-dichlorophenyl)methylsulfonyl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 100504416 |
| Molecular Formula | C23H27Cl2N3O3S |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | (3S)-1-[(2,6-dichlorophenyl)methylsulfonyl]-N-(4-pyrrolidin-1-ylphenyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)[C@H]1CCCN(S(=O)(=O)Cc2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C23H27Cl2N3O3S/c24-21-6-3-7-22(25)20(21)16-32(30,31)28-14-4-5-17(15-28)23(29)26-18-8-10-19(11-9-18)27-12-1-2-13-27/h3,6-11,17H,1-2,4-5,12-16H2,(H,26,29)/t17-/m0/s1 |
| InChIKey | UKSZJYPFALFCFF-KRWDZBQOSA-N |
| XLogP | 4.77 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|