C22H28F3N3O3S — CID 10050450
2-[4-[(1'S,4R,10'R)-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-yl]but-3-ynoxy]ethanamine (PubChem CID 10050450) has the molecular formula C22H28F3N3O3S and a molecular weight of 471.55 g/mol. Its IUPAC name is 2-[4-[(1'S,4R,10'R)-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-yl]but-3-ynoxy]ethanamine.
| Compound Name | 2-[4-[(1'S,4R,10'R)-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-yl]but-3-ynoxy]ethanamine |
|---|---|
| PubChem CID | 10050450 |
| Molecular Formula | C22H28F3N3O3S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 2-[4-[(1'S,4R,10'R)-1,1-dioxo-2-(2,2,2-trifluoroethyl)spiro[1,2,5-thiadiazolidine-4,13'-tricyclo[8.2.1.03,8]trideca-3(8),4,6-triene]-5'-yl]but-3-ynoxy]ethanamine |
| SMILES | NCCOCCC#Cc1ccc2c(c1)C[C@@H]1CC[C@H](C2)[C@]12CN(CC(F)(F)F)S(=O)(=O)N2 |
| InChI | InChI=1S/C22H28F3N3O3S/c23-22(24,25)15-28-14-21(27-32(28,29)30)19-6-7-20(21)13-18-11-16(4-5-17(18)12-19)3-1-2-9-31-10-8-26/h4-5,11,19-20,27H,2,6-10,12-15,26H2/t19-,20+,21-/m1/s1 |
| InChIKey | FGDYKTIZCAPASH-QHAWAJNXSA-N |
| XLogP | 1.98 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|