C22H13Cl2FN2O2 — CID 100505980
N-(2,5-dichlorophenyl)-2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]benzamide (PubChem CID 100505980) has the molecular formula C22H13Cl2FN2O2 and a molecular weight of 427.26 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]benzamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]benzamide |
|---|---|
| PubChem CID | 100505980 |
| Molecular Formula | C22H13Cl2FN2O2 |
| Molecular Weight | 427.26 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[5-(4-fluorophenyl)-1,3-oxazol-2-yl]benzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)c1ccccc1-c1ncc(-c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C22H13Cl2FN2O2/c23-14-7-10-18(24)19(11-14)27-21(28)16-3-1-2-4-17(16)22-26-12-20(29-22)13-5-8-15(25)9-6-13/h1-12H,(H,27,28) |
| InChIKey | ZOXPOLNCBROAFV-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.26 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |