C26H28N2O2 — CID 1005063
1-N,4-N-dibenzyl-1-N,4-N-diethylbenzene-1,4-dicarboxamide (PubChem CID 1005063) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-N,4-N-dibenzyl-1-N,4-N-diethylbenzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-dibenzyl-1-N,4-N-diethylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 1005063 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1-N,4-N-dibenzyl-1-N,4-N-diethylbenzene-1,4-dicarboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1ccc(C(=O)N(CC)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C26H28N2O2/c1-3-27(19-21-11-7-5-8-12-21)25(29)23-15-17-24(18-16-23)26(30)28(4-2)20-22-13-9-6-10-14-22/h5-18H,3-4,19-20H2,1-2H3 |
| InChIKey | XKIKZWDVZRCXHB-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |