C29H36N2O4 — CID 10050683
4-[2-[[(E)-3-(1-heptylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid (PubChem CID 10050683) has the molecular formula C29H36N2O4 and a molecular weight of 476.62 g/mol. Its IUPAC name is 4-[2-[[(E)-3-(1-heptylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid.
| Compound Name | 4-[2-[[(E)-3-(1-heptylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 10050683 |
| Molecular Formula | C29H36N2O4 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 4-[2-[[(E)-3-(1-heptylindol-5-yl)but-2-enoyl]amino]phenoxy]butanoic acid |
| SMILES | CCCCCCCn1ccc2cc(/C(C)=C/C(=O)Nc3ccccc3OCCCC(=O)O)ccc21 |
| InChI | InChI=1S/C29H36N2O4/c1-3-4-5-6-9-17-31-18-16-24-21-23(14-15-26(24)31)22(2)20-28(32)30-25-11-7-8-12-27(25)35-19-10-13-29(33)34/h7-8,11-12,14-16,18,20-21H,3-6,9-10,13,17,19H2,1-2H3,(H,30,32)(H,33,34)/b22-20+ |
| InChIKey | IXHQXYVHOWNNIL-LSDHQDQOSA-N |
| XLogP | 6.90 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|