About N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide
N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide (PubChem CID 10050685) has the molecular formula C26H24N2O3S2
and a molecular weight of 476.62 g/mol. Its IUPAC name is N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide.
Molecular Properties
| Compound Name | N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide |
| PubChem CID | 10050685 |
| Molecular Formula | C26H24N2O3S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide |
| SMILES | COc1ccc(-c2nc(CNC(=O)CSc3ccccc3)sc2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H24N2O3S2/c1-30-20-12-8-18(9-13-20)25-26(19-10-14-21(31-2)15-11-19)33-24(28-25)16-27-23(29)17-32-22-6-4-3-5-7-22/h3-15H,16-17H2,1-2H3,(H,27,29) |
| InChIKey | VHTQLHGCOZFBSU-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide?
The IUPAC name of N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide (CID 10050685) is N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide.
What is the SMILES notation for N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide?
The canonical SMILES for N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide is COc1ccc(-c2nc(CNC(=O)CSc3ccccc3)sc2-c2ccc(OC)cc2)cc1.
What is the InChIKey of N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide?
The InChIKey is VHTQLHGCOZFBSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O3S2/c1-30-20-12-8-18(9-13-20)25-26(19-10-14-21(31-2)15-11-19)33-24(28-25)16-27-23(29)17-32-22-6-4-3-5-7-22/h3-15H,16-17H2,1-2H3,(H,27,29).
What are the key properties of N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide?
N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide has a molecular weight of 476.62 g/mol, XLogP of 5.90, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4,5-bis(4-methoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-phenylsulfanylacetamide is sourced from PubChem (CID 10050685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).