C20H27N7O7 — CID 10050710
3-[[2-[(4S)-4-[3-(diaminomethylideneamino)propyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 10050710) has the molecular formula C20H27N7O7 and a molecular weight of 477.48 g/mol. Its IUPAC name is 3-[[2-[(4S)-4-[3-(diaminomethylideneamino)propyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | 3-[[2-[(4S)-4-[3-(diaminomethylideneamino)propyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 10050710 |
| Molecular Formula | C20H27N7O7 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 3-[[2-[(4S)-4-[3-(diaminomethylideneamino)propyl]-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | NC(N)=NCCC[C@@H]1NC(=O)N(CC(=O)NCC(NC(=O)OCc2ccccc2)C(=O)O)C1=O |
| InChI | InChI=1S/C20H27N7O7/c21-18(22)23-8-4-7-13-16(29)27(19(32)25-13)10-15(28)24-9-14(17(30)31)26-20(33)34-11-12-5-2-1-3-6-12/h1-3,5-6,13-14H,4,7-11H2,(H,24,28)(H,25,32)(H,26,33)(H,30,31)(H4,21,22,23)/t13-,14?/m0/s1 |
| InChIKey | UKUIUQNHAUNIMO-LSLKUGRBSA-N |
| XLogP | -1.54 |
| TPSA | 218.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|