C26H28ClN3O3S — CID 100510670
4-[(4-chlorophenyl)methyl-methylsulfonylamino]-N-(4-piperidin-1-ylphenyl)benzamide (PubChem CID 100510670) has the molecular formula C26H28ClN3O3S and a molecular weight of 498.05 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methyl-methylsulfonylamino]-N-(4-piperidin-1-ylphenyl)benzamide.
| Compound Name | 4-[(4-chlorophenyl)methyl-methylsulfonylamino]-N-(4-piperidin-1-ylphenyl)benzamide |
|---|---|
| PubChem CID | 100510670 |
| Molecular Formula | C26H28ClN3O3S |
| Molecular Weight | 498.05 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | 4-[(4-chlorophenyl)methyl-methylsulfonylamino]-N-(4-piperidin-1-ylphenyl)benzamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(Cl)cc1)c1ccc(C(=O)Nc2ccc(N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C26H28ClN3O3S/c1-34(32,33)30(19-20-5-9-22(27)10-6-20)25-13-7-21(8-14-25)26(31)28-23-11-15-24(16-12-23)29-17-3-2-4-18-29/h5-16H,2-4,17-19H2,1H3,(H,28,31) |
| InChIKey | JMVRSPICYXTTPV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.05 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|