C31H34O3S — CID 10051115
(7R)-10,13-dimethyl-4-phenoxy-7-phenylsulfanyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 10051115) has the molecular formula C31H34O3S and a molecular weight of 486.68 g/mol. Its IUPAC name is (7R)-10,13-dimethyl-4-phenoxy-7-phenylsulfanyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (7R)-10,13-dimethyl-4-phenoxy-7-phenylsulfanyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 10051115 |
| Molecular Formula | C31H34O3S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | (7R)-10,13-dimethyl-4-phenoxy-7-phenylsulfanyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CC12CCC3C(C(Sc4ccccc4)CC4=C(Oc5ccccc5)C(=O)CCC43C)C1CCC2=O |
| InChI | InChI=1S/C31H34O3S/c1-30-18-16-25(32)29(34-20-9-5-3-6-10-20)24(30)19-26(35-21-11-7-4-8-12-21)28-22-13-14-27(33)31(22,2)17-15-23(28)30/h3-12,22-23,26,28H,13-19H2,1-2H3 |
| InChIKey | CPKALGQGRVBNFS-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |