C25H50O5Si2 — CID 10051128
(1E,3S,4S,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,5-dien-3-ol (PubChem CID 10051128) has the molecular formula C25H50O5Si2 and a molecular weight of 486.84 g/mol. Its IUPAC name is (1E,3S,4S,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,5-dien-3-ol.
| Compound Name | (1E,3S,4S,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,5-dien-3-ol |
|---|---|
| PubChem CID | 10051128 |
| Molecular Formula | C25H50O5Si2 |
| Molecular Weight | 486.84 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | (1E,3S,4S,5E)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]hepta-1,5-dien-3-ol |
| SMILES | C/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)/C=C/[C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O5Si2/c1-14-15-20(30-32(12,13)24(5,6)7)19(26)16-17-21-22(29-25(8,9)28-21)18-27-31(10,11)23(2,3)4/h14-17,19-22,26H,18H2,1-13H3/b15-14+,17-16+/t19-,20-,21-,22-/m0/s1 |
| InChIKey | AHZDXCYHZXBUMI-GOSNGDMJSA-N |
| XLogP | 6.41 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.84 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|