C25H32N2O4 — CID 100511836
(2R)-N-cyclohexyl-2-[(4-methoxyphenyl)methyl-(2-phenoxyacetyl)amino]propanamide (PubChem CID 100511836) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is (2R)-N-cyclohexyl-2-[(4-methoxyphenyl)methyl-(2-phenoxyacetyl)amino]propanamide.
| Compound Name | (2R)-N-cyclohexyl-2-[(4-methoxyphenyl)methyl-(2-phenoxyacetyl)amino]propanamide |
|---|---|
| PubChem CID | 100511836 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (2R)-N-cyclohexyl-2-[(4-methoxyphenyl)methyl-(2-phenoxyacetyl)amino]propanamide |
| SMILES | COc1ccc(CN(C(=O)COc2ccccc2)[C@H](C)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C25H32N2O4/c1-19(25(29)26-21-9-5-3-6-10-21)27(17-20-13-15-22(30-2)16-14-20)24(28)18-31-23-11-7-4-8-12-23/h4,7-8,11-16,19,21H,3,5-6,9-10,17-18H2,1-2H3,(H,26,29)/t19-/m1/s1 |
| InChIKey | NAURPTGLANQRDH-LJQANCHMSA-N |
| XLogP | 3.94 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |