C23H17N5S4 — CID 10051308
(6,7-diphenyl-5-sulfanylidene-7H-[1,3,4]thiadiazolo[3,2-a][1,3,5]triazin-2-yl) N-phenylcarbamodithioate (PubChem CID 10051308) has the molecular formula C23H17N5S4 and a molecular weight of 491.69 g/mol. Its IUPAC name is (6,7-diphenyl-5-sulfanylidene-7H-[1,3,4]thiadiazolo[3,2-a][1,3,5]triazin-2-yl) N-phenylcarbamodithioate.
| Compound Name | (6,7-diphenyl-5-sulfanylidene-7H-[1,3,4]thiadiazolo[3,2-a][1,3,5]triazin-2-yl) N-phenylcarbamodithioate |
|---|---|
| PubChem CID | 10051308 |
| Molecular Formula | C23H17N5S4 |
| Molecular Weight | 491.69 g/mol |
| Exact Mass | 491.04 |
| IUPAC Name | (6,7-diphenyl-5-sulfanylidene-7H-[1,3,4]thiadiazolo[3,2-a][1,3,5]triazin-2-yl) N-phenylcarbamodithioate |
| SMILES | S=C(Nc1ccccc1)SC1=NN2C(=S)N(c3ccccc3)C(c3ccccc3)N=C2S1 |
| InChI | InChI=1S/C23H17N5S4/c29-21(24-17-12-6-2-7-13-17)32-22-26-28-20(31-22)25-19(16-10-4-1-5-11-16)27(23(28)30)18-14-8-3-9-15-18/h1-15,19H,(H,24,29) |
| InChIKey | IEOWSPWNMCOFJJ-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.69 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|