C28H32N2O4S — CID 10051348
(E)-6-pyridin-3-yl-6-[4-[2-[(2,4,6-trimethylphenyl)sulfonylamino]ethyl]phenyl]hex-5-enoic acid (PubChem CID 10051348) has the molecular formula C28H32N2O4S and a molecular weight of 492.64 g/mol. Its IUPAC name is (E)-6-pyridin-3-yl-6-[4-[2-[(2,4,6-trimethylphenyl)sulfonylamino]ethyl]phenyl]hex-5-enoic acid.
| Compound Name | (E)-6-pyridin-3-yl-6-[4-[2-[(2,4,6-trimethylphenyl)sulfonylamino]ethyl]phenyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 10051348 |
| Molecular Formula | C28H32N2O4S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.21 |
| IUPAC Name | (E)-6-pyridin-3-yl-6-[4-[2-[(2,4,6-trimethylphenyl)sulfonylamino]ethyl]phenyl]hex-5-enoic acid |
| SMILES | Cc1cc(C)c(S(=O)(=O)NCCc2ccc(/C(=C\CCCC(=O)O)c3cccnc3)cc2)c(C)c1 |
| InChI | InChI=1S/C28H32N2O4S/c1-20-17-21(2)28(22(3)18-20)35(33,34)30-16-14-23-10-12-24(13-11-23)26(8-4-5-9-27(31)32)25-7-6-15-29-19-25/h6-8,10-13,15,17-19,30H,4-5,9,14,16H2,1-3H3,(H,31,32)/b26-8+ |
| InChIKey | SOUOKSHPPGIZRL-MWRNPHMMSA-N |
| XLogP | 5.21 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|