C26H32Cl3N3O5S — CID 100514349
(2S)-N-cyclohexyl-2-[(4-methoxyphenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]propanamide (PubChem CID 100514349) has the molecular formula C26H32Cl3N3O5S and a molecular weight of 604.98 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[(4-methoxyphenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]propanamide.
| Compound Name | (2S)-N-cyclohexyl-2-[(4-methoxyphenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 100514349 |
| Molecular Formula | C26H32Cl3N3O5S |
| Molecular Weight | 604.98 g/mol |
| Exact Mass | 603.11 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[(4-methoxyphenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]propanamide |
| SMILES | COc1ccc(CN(C(=O)CN(c2cc(Cl)c(Cl)cc2Cl)S(C)(=O)=O)[C@@H](C)C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H32Cl3N3O5S/c1-17(26(34)30-19-7-5-4-6-8-19)31(15-18-9-11-20(37-2)12-10-18)25(33)16-32(38(3,35)36)24-14-22(28)21(27)13-23(24)29/h9-14,17,19H,4-8,15-16H2,1-3H3,(H,30,34)/t17-/m0/s1 |
| InChIKey | RMMLAYVOUOQNFU-KRWDZBQOSA-N |
| XLogP | 5.29 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.98 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|