C33H37FN2O — CID 10051533
1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-5-propan-2-ylspiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 10051533) has the molecular formula C33H37FN2O and a molecular weight of 496.67 g/mol. Its IUPAC name is 1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-5-propan-2-ylspiro[1H-2-benzofuran-3,4'-piperidine].
| Compound Name | 1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-5-propan-2-ylspiro[1H-2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 10051533 |
| Molecular Formula | C33H37FN2O |
| Molecular Weight | 496.67 g/mol |
| Exact Mass | 496.29 |
| IUPAC Name | 1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]-5-propan-2-ylspiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | CC(C)c1ccc2c(c1)C1(CCN(CCCCc3cn(-c4ccc(F)cc4)c4ccccc34)CC1)OC2 |
| InChI | InChI=1S/C33H37FN2O/c1-24(2)25-10-11-27-23-37-33(31(27)21-25)16-19-35(20-17-33)18-6-5-7-26-22-36(29-14-12-28(34)13-15-29)32-9-4-3-8-30(26)32/h3-4,8-15,21-22,24H,5-7,16-20,23H2,1-2H3 |
| InChIKey | UGCPUNXFTVSQMP-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.67 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|