C24H31FN2O2 — CID 100515352
(2R)-2-[[2-(4-fluorophenyl)acetyl]-(2-phenylethyl)amino]-N-(2-methylpropyl)butanamide (PubChem CID 100515352) has the molecular formula C24H31FN2O2 and a molecular weight of 398.52 g/mol. Its IUPAC name is (2R)-2-[[2-(4-fluorophenyl)acetyl]-(2-phenylethyl)amino]-N-(2-methylpropyl)butanamide.
| Compound Name | (2R)-2-[[2-(4-fluorophenyl)acetyl]-(2-phenylethyl)amino]-N-(2-methylpropyl)butanamide |
|---|---|
| PubChem CID | 100515352 |
| Molecular Formula | C24H31FN2O2 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | (2R)-2-[[2-(4-fluorophenyl)acetyl]-(2-phenylethyl)amino]-N-(2-methylpropyl)butanamide |
| SMILES | CC[C@H](C(=O)NCC(C)C)N(CCc1ccccc1)C(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C24H31FN2O2/c1-4-22(24(29)26-17-18(2)3)27(15-14-19-8-6-5-7-9-19)23(28)16-20-10-12-21(25)13-11-20/h5-13,18,22H,4,14-17H2,1-3H3,(H,26,29)/t22-/m1/s1 |
| InChIKey | QKMHQBRWOLLWHV-JOCHJYFZSA-N |
| XLogP | 3.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |